CAS 1493318-64-1 is the registry number for 1-(2-(4-Chlorophenyl)ethyl)-1H-1,3-benzodiazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[2-(4-chlorophenyl)ethyl]benzimidazol-5-amine (CAS 1493318-64-1) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 1-[2-(4-chlorophenyl)ethyl]benzimidazol-5-amine. InChIKey: VEEUZMFPRKMESM-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 1-[2-(4-chlorophenyl)ethyl]benzimidazol-5-amine |
| InChIKey | VEEUZMFPRKMESM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN2C=NC3=C2C=CC(=C3)N)Cl |
Computed by PubChem (NCBI)