Products 2395821-96-0
CAS 2395821-96-0 is the registry number for 2-Chloro-4-phenyl-7,8-dihydro-6H-5,8-ethanopyrido[3,2-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-triene (CAS 2395821-96-0) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 5-chloro-3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-triene. InChIKey: QTTMRBRUTBSKSU-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-triene |
| InChIKey | QTTMRBRUTBSKSU-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C3=NC(=NC(=C32)C4=CC=CC=C4)Cl |
Computed by PubChem (NCBI)