Products 10317-70-1
CAS 10317-70-1 appears in our catalog under these names: 1–bromo–2–methyl–4–nitronaphthalene, 1-bromo-2-methyl-4-nitronaphthalene, 98%. Offered by: GLPBio, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 10g.
1-bromo-2-methyl-4-nitronaphthalene (CAS 10317-70-1) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 1-bromo-2-methyl-4-nitronaphthalene. InChIKey: AGCHLHCQCLRWOJ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 1-bromo-2-methyl-4-nitronaphthalene |
| InChIKey | AGCHLHCQCLRWOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)