Products 1031926-87-0
CAS 1031926-87-0 is the registry number for 2,2-Difluoro-5-isopropylcyclohexane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-5-propan-2-ylcyclohexane-1,3-dione (CAS 1031926-87-0) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: 2,2-difluoro-5-propan-2-ylcyclohexane-1,3-dione. InChIKey: JFWMFERJFZESBV-UHFFFAOYSA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 2,2-difluoro-5-propan-2-ylcyclohexane-1,3-dione |
| InChIKey | JFWMFERJFZESBV-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC(=O)C(C(=O)C1)(F)F |
Computed by PubChem (NCBI)