Products 1447943-49-8

CAS 1447943-49-8 appears in our catalog under these names: 1,1-difluorospiro(2.5)octane-6-carboxylic acid, 1,1-Difluorospiro[2.5]octane-6-carboxylic acid, 97%, 97%, 1,1-DIFLUOROSPIRO[2.5]OCTANE-6-CARBOXYLIC ACID, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,2-difluorospiro[2.5]octane-6-carboxylic acid (CAS 1447943-49-8) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: 2,2-difluorospiro[2.5]octane-6-carboxylic acid. InChIKey: RVASSHNVWZETBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12F2O2
Molecular weight190.19 g/mol
IUPAC name2,2-difluorospiro[2.5]octane-6-carboxylic acid
InChIKeyRVASSHNVWZETBJ-UHFFFAOYSA-N
SMILESC1CC2(CCC1C(=O)O)CC2(F)F

Computed by PubChem (NCBI)