Products 2551157-11-8
CAS 2551157-11-8 is the registry number for Ethyl 3-cyclopropyl-4,4-difluorobut-2-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (Z)-3-cyclopropyl-4,4-difluorobut-2-enoate (CAS 2551157-11-8) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: ethyl (Z)-3-cyclopropyl-4,4-difluorobut-2-enoate. InChIKey: KWIOFYHXAQIWCN-ALCCZGGFSA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | ethyl (Z)-3-cyclopropyl-4,4-difluorobut-2-enoate |
| InChIKey | KWIOFYHXAQIWCN-ALCCZGGFSA-N |
| SMILES | CCOC(=O)/C=C(/C1CC1)\C(F)F |
Computed by PubChem (NCBI)