Products 2572387-74-5
CAS 2572387-74-5 is the registry number for 2-(3-(Difluoromethyl)cyclohex-2-en-1-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(difluoromethyl)cyclohex-2-en-1-yl]acetic acid (CAS 2572387-74-5) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: 2-[3-(difluoromethyl)cyclohex-2-en-1-yl]acetic acid. InChIKey: NMZXKRGAJXMNQN-UHFFFAOYSA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 2-[3-(difluoromethyl)cyclohex-2-en-1-yl]acetic acid |
| InChIKey | NMZXKRGAJXMNQN-UHFFFAOYSA-N |
| SMILES | C1CC(C=C(C1)C(F)F)CC(=O)O |
Computed by PubChem (NCBI)