CAS 2770345-67-8 is the registry number for Rel-(3S,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one (CAS 2770345-67-8) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: (3S,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one. InChIKey: CYYTXGMHBWVRHZ-YUMQZZPRSA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3S,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one |
| InChIKey | CYYTXGMHBWVRHZ-YUMQZZPRSA-N |
| SMILES | C1CC2(CCC1=O)[C@H]([C@H](CO2)F)F |
Computed by PubChem (NCBI)