CAS 2770345-68-9 is the registry number for Rel-(3R,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one (CAS 2770345-68-9) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: (3R,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one. InChIKey: CYYTXGMHBWVRHZ-SFYZADRCSA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3R,4R)-3,4-difluoro-1-oxaspiro[4.5]decan-8-one |
| InChIKey | CYYTXGMHBWVRHZ-SFYZADRCSA-N |
| SMILES | C1CC2(CCC1=O)[C@H]([C@@H](CO2)F)F |
Computed by PubChem (NCBI)