CAS 103204-68-8 appears in our catalog under these names: 3-Acetamido-2-methylbenzoic acid, 98%, 3-Acetamido-2-methylbenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
3-acetamido-2-methylbenzoic acid (CAS 103204-68-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-acetamido-2-methylbenzoic acid. InChIKey: NWXFTFZSOVTXIX-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-acetamido-2-methylbenzoic acid |
| InChIKey | NWXFTFZSOVTXIX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)