CAS 103262-22-2 is the registry number for 1-Benzyl-1H-1,2,4-triazol-5-amine. Offered by: TRC. Available pack sizes: 750mg.
2-benzyl-1,2,4-triazol-3-amine (CAS 103262-22-2) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 2-benzyl-1,2,4-triazol-3-amine. InChIKey: FEKTZCRTGOLRRL-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-benzyl-1,2,4-triazol-3-amine |
| InChIKey | FEKTZCRTGOLRRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC=N2)N |
Computed by PubChem (NCBI)