CAS 103310-88-9 appears in our catalog under these names: benzyl (2s,3s)-2-amino-3-methylpentanoate hydrochloride, 95%, Benzyl L-isoleucinate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
Benzyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 103310-88-9) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: benzyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: KGVGWRRIIMXOQH-JGAZGGJJSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | benzyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | KGVGWRRIIMXOQH-JGAZGGJJSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)