CAS 1240527-20-1 appears in our catalog under these names: 4-([Ethyl(propan-2-yl)amino]methyl)benzoic acid hydrochloride, 95%, 4-{(ethyl(propan-2-yl)amino)methyl}benzoic acid hydrochloride, 95%, 4-{(Ethyl(propan-2-yl)amino)methyl}benzoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
4-[[ethyl(propan-2-yl)amino]methyl]benzoic acid;hydrochloride (CAS 1240527-20-1) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: 4-[[ethyl(propan-2-yl)amino]methyl]benzoic acid;hydrochloride. InChIKey: IZWAPTOYUOCZGX-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | 4-[[ethyl(propan-2-yl)amino]methyl]benzoic acid;hydrochloride |
| InChIKey | IZWAPTOYUOCZGX-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=C(C=C1)C(=O)O)C(C)C.Cl |
Computed by PubChem (NCBI)