Products 1956306-26-5

CAS 1956306-26-5 is the registry number for 2-(Butyl(methyl)amino)-2-phenylacetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-[butyl(methyl)amino]-2-phenylacetic acid;hydrochloride (CAS 1956306-26-5) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: 2-[butyl(methyl)amino]-2-phenylacetic acid;hydrochloride. InChIKey: UXVYSCRINJZQQE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20ClNO2
Molecular weight257.75 g/mol
IUPAC name2-[butyl(methyl)amino]-2-phenylacetic acid;hydrochloride
InChIKeyUXVYSCRINJZQQE-UHFFFAOYSA-N
SMILESCCCCN(C)C(C1=CC=CC=C1)C(=O)O.Cl

Computed by PubChem (NCBI)