CAS 142524-46-7 appears in our catalog under these names: methyl 2-amino-2-(4-tert-butylphenyl)acetate hydrochloride, 95%, Methyl2-amino-2-(4-tert-butylphenyl)acetate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-amino-2-(4-tert-butylphenyl)acetate;hydrochloride (CAS 142524-46-7) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: methyl 2-amino-2-(4-tert-butylphenyl)acetate;hydrochloride. InChIKey: FYHUABVEACULFO-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | methyl 2-amino-2-(4-tert-butylphenyl)acetate;hydrochloride |
| InChIKey | FYHUABVEACULFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)