Products 33625-43-3

CAS 33625-43-3 appears in our catalog under these names: 2,5-Dimethyl-4-(4-morpholinylmethyl)phenol hydrochloride hydrate, 95%, 2,5-Dimethyl-4-(morpholinomethyl)phenol hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

2,5-dimethyl-4-(morpholin-4-ylmethyl)phenol;hydrochloride (CAS 33625-43-3) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: 2,5-dimethyl-4-(morpholin-4-ylmethyl)phenol;hydrochloride. InChIKey: RLGUYDSHQWRANT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20ClNO2
Molecular weight257.75 g/mol
IUPAC name2,5-dimethyl-4-(morpholin-4-ylmethyl)phenol;hydrochloride
InChIKeyRLGUYDSHQWRANT-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1O)C)CN2CCOCC2.Cl

Computed by PubChem (NCBI)