CAS 2137640-50-5 appears in our catalog under these names: 3-amino-3-(4-(tert-butyl)phenyl)propanoic acid hydrochloride, 95%, 3-Amino-3-(4-(tert-butyl)phenyl)propanoic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
3-amino-3-(4-tert-butylphenyl)propanoic acid;hydrochloride (CAS 2137640-50-5) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: 3-amino-3-(4-tert-butylphenyl)propanoic acid;hydrochloride. InChIKey: HQDNAMPVIGROSG-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | 3-amino-3-(4-tert-butylphenyl)propanoic acid;hydrochloride |
| InChIKey | HQDNAMPVIGROSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)