Products 1033203-06-3
CAS 1033203-06-3 is the registry number for 3-Methylpyridine-2,5-dicarboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
3-methylpyridine-2,5-dicarboxylic acid (CAS 1033203-06-3) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 3-methylpyridine-2,5-dicarboxylic acid. InChIKey: JOMNLNYASZMDBM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-methylpyridine-2,5-dicarboxylic acid |
| InChIKey | JOMNLNYASZMDBM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Pyridinedicarboxylic acid, 3-methyl-