CAS 1033464-75-3 appears in our catalog under these names: 2-Methyl-2h-1,2,3-benzotriazole-4-sulfonyl chloride, 95%, 2-Methyl-2H-benzo(d)(1,2,3)triazole-4-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-methylbenzotriazole-4-sulfonyl chloride (CAS 1033464-75-3) is a chemical compound with the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. IUPAC name: 2-methylbenzotriazole-4-sulfonyl chloride. InChIKey: QZQHYAJAYCBGFU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 2-methylbenzotriazole-4-sulfonyl chloride |
| InChIKey | QZQHYAJAYCBGFU-UHFFFAOYSA-N |
| SMILES | CN1N=C2C=CC=C(C2=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)