CAS 175965-05-6 is the registry number for 7-Methyl-(1,2,4)triazolo(1,5-a)pyridine-2-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride (CAS 175965-05-6) is a chemical compound with the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. IUPAC name: 7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride. InChIKey: PZUOJSXZBNPRDQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride |
| InChIKey | PZUOJSXZBNPRDQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=NN2C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)