CAS 1363381-40-1 appears in our catalog under these names: 4-Chloro-5-(methylsulfonyl)-7h-pyrrolo[2,3-d]pyrimidine, 95%, 4-Chloro-5-(methylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 95+%, 95+%, 4-CHLORO-5-(METHYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-5-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 1363381-40-1) is a chemical compound with the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. IUPAC name: 4-chloro-5-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: NYNPBYKQGURQND-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 4-chloro-5-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | NYNPBYKQGURQND-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CNC2=C1C(=NC=N2)Cl |
Computed by PubChem (NCBI)