Products 1820648-83-6
CAS 1820648-83-6 is the registry number for 2-Chloro-1H-1,3-benzodiazole-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-3H-benzimidazole-5-sulfonamide (CAS 1820648-83-6) is a chemical compound with the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. IUPAC name: 2-chloro-3H-benzimidazole-5-sulfonamide. InChIKey: IRQNDFPIDNJXRS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 2-chloro-3H-benzimidazole-5-sulfonamide |
| InChIKey | IRQNDFPIDNJXRS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)N)NC(=N2)Cl |
Computed by PubChem (NCBI)