Products 2090706-08-2
CAS 2090706-08-2 is the registry number for Antibacterial agent 259. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-chloro-3-methylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine (CAS 2090706-08-2) is a chemical compound with the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. IUPAC name: 8-chloro-3-methylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: LZXZPRHKNWECPB-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 8-chloro-3-methylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | LZXZPRHKNWECPB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C2N1C=CC=C2Cl |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 259, orb2945867