Products 2230808-51-0
CAS 2230808-51-0 is the registry number for 4-Nitro-1,3-benzothiazol-5-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-nitro-1,3-benzothiazol-5-amine;hydrochloride (CAS 2230808-51-0) is a chemical compound with the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. IUPAC name: 4-nitro-1,3-benzothiazol-5-amine;hydrochloride. InChIKey: NSGBQZDYZAQBPU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 4-nitro-1,3-benzothiazol-5-amine;hydrochloride |
| InChIKey | NSGBQZDYZAQBPU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1N)[N+](=O)[O-])N=CS2.Cl |
Computed by PubChem (NCBI)