CAS 103365-69-1 appears in our catalog under these names: 1-Methyl-L-4,5-dihydroorotic Acid, 1-Methyl-L-4,5-dihydroorotic acid, 98%, (S)-1-Methyl-2,6-dioxohexahydropyrimidine-4-carboxylic acid 97%, (S)-1-Methyl-2,6-dioxohexahydropyrimidine-4-carboxylic acid, 98%, 98%. Offered by: TRC, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 250mg.
(4S)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid (CAS 103365-69-1) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: (4S)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid. InChIKey: GWHDGNNXTNENIF-VKHMYHEASA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | (4S)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| InChIKey | GWHDGNNXTNENIF-VKHMYHEASA-N |
| SMILES | CN1C(=O)C[C@H](NC1=O)C(=O)O |
Computed by PubChem (NCBI)