Products 124916-92-3

CAS 124916-92-3 is the registry number for Taltirelin Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4R)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid (CAS 124916-92-3) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: (4R)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid. InChIKey: GWHDGNNXTNENIF-GSVOUGTGSA-N.

Identity
Molecular formulaC6H8N2O4
Molecular weight172.14 g/mol
IUPAC name(4R)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid
InChIKeyGWHDGNNXTNENIF-GSVOUGTGSA-N
SMILESCN1C(=O)C[C@@H](NC1=O)C(=O)O

Computed by PubChem (NCBI)