CAS 124916-92-3 is the registry number for Taltirelin Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid (CAS 124916-92-3) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: (4R)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid. InChIKey: GWHDGNNXTNENIF-GSVOUGTGSA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | (4R)-1-methyl-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| InChIKey | GWHDGNNXTNENIF-GSVOUGTGSA-N |
| SMILES | CN1C(=O)C[C@@H](NC1=O)C(=O)O |
Computed by PubChem (NCBI)