CAS 1033697-65-2 is the registry number for tert-Butyl 3-bromo-6-oxo-3,6-dihydropyridine-1(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromo-6-oxo-2,3-dihydropyridine-1-carboxylate (CAS 1033697-65-2) is a chemical compound with the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. IUPAC name: tert-butyl 3-bromo-6-oxo-2,3-dihydropyridine-1-carboxylate. InChIKey: ULILWQKGILNYGA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-oxo-2,3-dihydropyridine-1-carboxylate |
| InChIKey | ULILWQKGILNYGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C=CC1=O)Br |
Computed by PubChem (NCBI)