Products 141899-12-9
CAS 141899-12-9 appears in our catalog under these names: Homo-L-tyrosine HBr, 97%, Homo-L-tyrosine Hydrobromide, H–HoTyr–OH?HBr, H-L-HTyr-OH*HBr, H-HoTyr-OH·HBr 96%. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 100mg, 500mg, 100g.
(2S)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide (CAS 141899-12-9) is a chemical compound with the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. IUPAC name: (2S)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide. InChIKey: URCVTTXLQQVTHD-FVGYRXGTSA-N.
| Molecular formula | C10H14BrNO3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | (2S)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide |
| InChIKey | URCVTTXLQQVTHD-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1CC[C@@H](C(=O)O)N)O.Br |
Computed by PubChem (NCBI)
Synonyms:
HOMO-L-Tyrosine HBr, (S)-2-Amino-4-(4-hydroxyphenyl)butanoic acid hydrobromide, H-HoTyr-OH.HBr, Homo-L-tyrosine Hydrobromide, L-Homotyrosine hydrobromide, (2S)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide, (S)-4-Hydroxy-homophenylalanine HBr, L-HomoTyr-OH HBr, HOMO-L-TYROSINEHBR, (alphaS)-Amino-4-hydroxybenzenebutanoic Acid Hydrobromide;