CAS 185617-14-5 appears in our catalog under these names: D-Homotyrosine hydrobromide, 96%, D-Homotyrosine Hydrobromide, H-D-HTyr-OH*HBr, H-D-HoTyr-OH HBr 98%, (R)-2-Amino-4-(4-hydroxyphenyl)butanoic acid hydrobromide, 98%, 98%. Offered by: Combi-blocks, TRC, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 10mg, 50mg, 5mg, 100mg.
(2R)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide (CAS 185617-14-5) is a chemical compound with the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. IUPAC name: (2R)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide. InChIKey: URCVTTXLQQVTHD-SBSPUUFOSA-N.
| Molecular formula | C10H14BrNO3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | (2R)-2-amino-4-(4-hydroxyphenyl)butanoic acid;hydrobromide |
| InChIKey | URCVTTXLQQVTHD-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1CC[C@H](C(=O)O)N)O.Br |
Computed by PubChem (NCBI)