Products 2724270-76-0
CAS 2724270-76-0 is the registry number for Ethyl 2-(3-bromoisoxazol-5-yl)-3-methylbutanoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoate (CAS 2724270-76-0) is a chemical compound with the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. IUPAC name: ethyl 2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoate. InChIKey: ZUXCDHSDJIJNCL-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | ethyl 2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoate |
| InChIKey | ZUXCDHSDJIJNCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=NO1)Br)C(C)C |
Computed by PubChem (NCBI)