Products 1234216-79-5
CAS 1234216-79-5 is the registry number for 2-Amino-1-(3,4-dimethoxyphenyl)ethan-1-one hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-amino-1-(3,4-dimethoxyphenyl)ethanone;hydrobromide (CAS 1234216-79-5) is a chemical compound with the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. IUPAC name: 2-amino-1-(3,4-dimethoxyphenyl)ethanone;hydrobromide. InChIKey: HYLGBCRSSGXFMG-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 2-amino-1-(3,4-dimethoxyphenyl)ethanone;hydrobromide |
| InChIKey | HYLGBCRSSGXFMG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CN)OC.Br |
Computed by PubChem (NCBI)