CAS 156496-92-3 is the registry number for tert-Butyl 4-bromo-3-oxo-1,2,3,6-tetrahydropyridine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-bromo-3-oxo-2,6-dihydropyridine-1-carboxylate (CAS 156496-92-3) is a chemical compound with the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. IUPAC name: tert-butyl 4-bromo-3-oxo-2,6-dihydropyridine-1-carboxylate. InChIKey: JKXASHFASIJCPO-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO3 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-oxo-2,6-dihydropyridine-1-carboxylate |
| InChIKey | JKXASHFASIJCPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C(C(=O)C1)Br |
Computed by PubChem (NCBI)