CAS 1034000-36-6 appears in our catalog under these names: methyl N-[(3R)-6,8-difluorochroman-3-yl]carbamate, 97%, 97%, METHYL N-[(3R)-6,8-DIFLUOROCHROMAN-3-YL]CARBAMATE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl N-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]carbamate (CAS 1034000-36-6) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: methyl N-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]carbamate. InChIKey: TZCLAZJPZGHFBN-MRVPVSSYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | methyl N-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]carbamate |
| InChIKey | TZCLAZJPZGHFBN-MRVPVSSYSA-N |
| SMILES | COC(=O)N[C@@H]1CC2=C(C(=CC(=C2)F)F)OC1 |
Computed by PubChem (NCBI)