Products 1356955-69-5
CAS 1356955-69-5 is the registry number for (2-(3,5-Difluorophenyl)acetyl)-D-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoic acid (CAS 1356955-69-5) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: (2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoic acid. InChIKey: WMFFVAZKIWXNQV-ZCFIWIBFSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | (2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoic acid |
| InChIKey | WMFFVAZKIWXNQV-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)CC1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)