CAS 266360-55-8 appears in our catalog under these names: N-Acetyl-3-(2,5-difluorophenyl)-d-alanine, 95%, (R)-2-Acetamido-3-(2,5-difluorophenyl)propanoic acid, 97%, (R)-2-Acetamido-3-(2,5-difluorophenyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2R)-2-acetamido-3-(2,5-difluorophenyl)propanoic acid (CAS 266360-55-8) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: (2R)-2-acetamido-3-(2,5-difluorophenyl)propanoic acid. InChIKey: WJRDSRFBLPWNBZ-SNVBAGLBSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(2,5-difluorophenyl)propanoic acid |
| InChIKey | WJRDSRFBLPWNBZ-SNVBAGLBSA-N |
| SMILES | CC(=O)N[C@H](CC1=C(C=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)