CAS 155601-70-0 is the registry number for tert-Butyl 2-(2,6-difluoropyridin-3-yl)-2-oxoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 2-(2,6-difluoro-3-pyridinyl)-2-oxoacetate (CAS 155601-70-0) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: tert-butyl 2-(2,6-difluoro-3-pyridinyl)-2-oxoacetate. InChIKey: XYHCOPQELBEQAZ-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | tert-butyl 2-(2,6-difluoro-3-pyridinyl)-2-oxoacetate |
| InChIKey | XYHCOPQELBEQAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=O)C1=C(N=C(C=C1)F)F |
Computed by PubChem (NCBI)