Products 1430223-92-9
CAS 1430223-92-9 appears in our catalog under these names: 2,5-Difluoro-4-morpholin-4-ylbenzoic acid, 95%, 2,5-Difluoro-4-morpholin-4-ylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
2,5-difluoro-4-morpholin-4-ylbenzoic acid (CAS 1430223-92-9) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: 2,5-difluoro-4-morpholin-4-ylbenzoic acid. InChIKey: FHZWGXCSLFMTNO-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2,5-difluoro-4-morpholin-4-ylbenzoic acid |
| InChIKey | FHZWGXCSLFMTNO-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C(=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)