Products 1881332-23-5
CAS 1881332-23-5 is the registry number for 1-(cyclopentyloxy)-2,3-difluoro-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-cyclopentyloxy-2,3-difluoro-4-nitrobenzene (CAS 1881332-23-5) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: 1-cyclopentyloxy-2,3-difluoro-4-nitrobenzene. InChIKey: LPOJFXMLMXKSEQ-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 1-cyclopentyloxy-2,3-difluoro-4-nitrobenzene |
| InChIKey | LPOJFXMLMXKSEQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C(=C(C=C2)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)