CAS 103440-70-6 appears in our catalog under these names: 2-(2-Methoxy-5-nitrophenoxy)acetic acid, 98%, 2-(2-Methoxy-5-nitrophenoxy)acetic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 500mg, 2.5g, 25g.
2-(2-methoxy-5-nitrophenoxy)acetic acid (CAS 103440-70-6) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 2-(2-methoxy-5-nitrophenoxy)acetic acid. InChIKey: XBHFRUXMKJREHN-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2-(2-methoxy-5-nitrophenoxy)acetic acid |
| InChIKey | XBHFRUXMKJREHN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OCC(=O)O |
Computed by PubChem (NCBI)