Products 103494-84-4
CAS 103494-84-4 is the registry number for 2,4-Dichloro-6,7,8,9-tetrahydrobenzo[g]quinazoline, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
2,4-dichloro-6,7,8,9-tetrahydrobenzo[g]quinazoline (CAS 103494-84-4) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 2,4-dichloro-6,7,8,9-tetrahydrobenzo[g]quinazoline. InChIKey: WNJHXNSTUNDGTM-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 2,4-dichloro-6,7,8,9-tetrahydrobenzo[g]quinazoline |
| InChIKey | WNJHXNSTUNDGTM-UHFFFAOYSA-N |
| SMILES | C1CCC2=CC3=C(C=C2C1)C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)