CAS 103515-98-6 appears in our catalog under these names: 4,7-Dibromo-2,3-dihydro-1H-inden-1-one, 4,7-Dibromo-2,3-dihydro-1H-inden-1-one 97%, 4,7-Dibromo-2,3-dihydro-1H-inden-1-one, 97%, 97%, 4,7-Dibromo-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 50mg, 100mg, 250mg, 5g.
4,7-dibromo-2,3-dihydroinden-1-one (CAS 103515-98-6) is a chemical compound with the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. IUPAC name: 4,7-dibromo-2,3-dihydroinden-1-one. InChIKey: ICHPPVPABKMELS-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 4,7-dibromo-2,3-dihydroinden-1-one |
| InChIKey | ICHPPVPABKMELS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Br)Br |
Computed by PubChem (NCBI)