CAS 1344903-40-7 is the registry number for 6,7-Dibromo-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dibromo-2,3-dihydroinden-1-one (CAS 1344903-40-7) is a chemical compound with the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. IUPAC name: 6,7-dibromo-2,3-dihydroinden-1-one. InChIKey: CBOZVXFGTVIPOR-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 6,7-dibromo-2,3-dihydroinden-1-one |
| InChIKey | CBOZVXFGTVIPOR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Br)Br |
Computed by PubChem (NCBI)