CAS 7749-02-2 is the registry number for 2,2-Dibromo-2,3-dihydro-1H-inden-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,2-dibromo-3H-inden-1-one (CAS 7749-02-2) is a chemical compound with the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. IUPAC name: 2,2-dibromo-3H-inden-1-one. InChIKey: VGEJBODXYMOIGZ-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 2,2-dibromo-3H-inden-1-one |
| InChIKey | VGEJBODXYMOIGZ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)C1(Br)Br |
Computed by PubChem (NCBI)