CAS 1289167-38-9 appears in our catalog under these names: 5,6-Dibromo-2,3-dihydro-1H-inden-1-one 97%, 5,6-Dibromo-2,3-dihydro-1H-inden-1-one, 97%, 97%, 5,6-Dibromo-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,6-dibromo-2,3-dihydroinden-1-one (CAS 1289167-38-9) is a chemical compound with the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. IUPAC name: 5,6-dibromo-2,3-dihydroinden-1-one. InChIKey: HXZOVINLHZFQFM-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 5,6-dibromo-2,3-dihydroinden-1-one |
| InChIKey | HXZOVINLHZFQFM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Br)Br |
Computed by PubChem (NCBI)