CAS 1188141-94-7 appears in our catalog under these names: 2,6-Dibromo-2,3-dihydro-1H-inden-1-one, 95%, 2,6-Dibromo-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-dibromo-2,3-dihydroinden-1-one (CAS 1188141-94-7) is a chemical compound with the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. IUPAC name: 2,6-dibromo-2,3-dihydroinden-1-one. InChIKey: KZYIZXUHEKUDQW-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 2,6-dibromo-2,3-dihydroinden-1-one |
| InChIKey | KZYIZXUHEKUDQW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=C1C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)