CAS 207857-48-5 appears in our catalog under these names: 4,6-Dibromo-2,3-dihydro-1h-inden-1-one, 95%, 4,6–Dibromo–2,3–dihydro–1H–Inden–1–one, 4,6-Dibromo-2,3-dihydro-1H-inden-1-one, 98%, 98%, 4,6-Dibromo-2,3-dihydro-1H-Inden-1-one, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
4,6-dibromo-2,3-dihydroinden-1-one (CAS 207857-48-5) is a chemical compound with the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. IUPAC name: 4,6-dibromo-2,3-dihydroinden-1-one. InChIKey: WUQSDHZHCNOIJP-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 4,6-dibromo-2,3-dihydroinden-1-one |
| InChIKey | WUQSDHZHCNOIJP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)