Products 1035371-14-2
CAS 1035371-14-2 is the registry number for ethyl 3-(2,4-difluoro-phenyl)-1H-pyrazole-5-carboxylate, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Ethyl 3-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylate (CAS 1035371-14-2) is a chemical compound with the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. IUPAC name: ethyl 3-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylate. InChIKey: RDYNIFMEPCVCSA-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O2 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | ethyl 3-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | RDYNIFMEPCVCSA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)