CAS 10354-00-4 appears in our catalog under these names: Dibenzosuberenol, Dibenzosuberenol, >95% (HPLC), Dibenzosuberenol 98%, 5H-Dibenzo[a,d][7]annulen-5-ol, 98%, 98%, 5H-Dibenzo[a,d][7]annulen-5-ol, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 1g, 2,5g, 500mg, 10g, 25g, 5g, 100mg.
Tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol (CAS 10354-00-4) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol. InChIKey: SRIISEYIFDTFRZ-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol |
| InChIKey | SRIISEYIFDTFRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(C3=CC=CC=C3C=CC2=C1)O |
Computed by PubChem (NCBI)