Products 103646-38-4

CAS 103646-38-4 is the registry number for Polaprezinc Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-carboxyethylcarbamoyl)benzoic acid (CAS 103646-38-4) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: 2-(2-carboxyethylcarbamoyl)benzoic acid. InChIKey: WHTKKIHBHVDWGK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO5
Molecular weight237.21 g/mol
IUPAC name2-(2-carboxyethylcarbamoyl)benzoic acid
InChIKeyWHTKKIHBHVDWGK-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NCCC(=O)O)C(=O)O

Computed by PubChem (NCBI)