Products 1036565-76-0

CAS 1036565-76-0 is the registry number for 1-((Naphthalen-1-yl)methyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxylic acid (CAS 1036565-76-0) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxylic acid. InChIKey: CTWLHNDBIKOZSN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO3
Molecular weight279.29 g/mol
IUPAC name1-(naphthalen-1-ylmethyl)-6-oxopyridine-3-carboxylic acid
InChIKeyCTWLHNDBIKOZSN-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2CN3C=C(C=CC3=O)C(=O)O

Computed by PubChem (NCBI)